CAS 1261895-41-3

5-(4-Fluoro-2-hydroxyphenyl)-2(1H)-pyridinone

Description:

5-(4-Fluoro-2-hydroxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1261895-41-3, is a chemical compound characterized by its unique structural features, which include a pyridinone core and a substituted phenyl group. The presence of a fluorine atom and a hydroxyl group on the phenyl ring contributes to its potential biological activity and solubility properties. This compound may exhibit various chemical behaviors, such as hydrogen bonding due to the hydroxyl group, and it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the fluorine atom. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such modifications can influence the compound's efficacy and selectivity. Additionally, the compound's stability, reactivity, and interaction with biological targets would be of interest in research contexts, particularly in the fields of drug design and development. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₁H₈FNO₂

InChI: InChI=1S/C11H8FNO2/c12-8-2-3-9(10(14)5-8)7-1-4-11(15)13-6-7/h1-6,14H,(H,13,15)

InChI key: InChIKey=FDLJFSZJCDDYBZ-UHFFFAOYSA-N

SMILES: OC1=C(C=2C=CC(=O)NC2)C=CC(F)=C1

Synonyms:

• 2(1H)-Pyridinone, 5-(4-fluoro-2-hydroxyphenyl)-
• 5-(4-Fluoro-2-hydroxyphenyl)-2(1H)-pyridinone