CAS 1261895-42-4

[1,1′-Biphenyl]-4-ol, 3-fluoro-2′-methoxy-

Description:

[1,1′-Biphenyl]-4-ol, 3-fluoro-2′-methoxy- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the para position of one phenyl ring contributes to its classification as a phenolic compound, which often exhibits antioxidant properties. The compound also features a methoxy group (-OCH₃) at the ortho position relative to the hydroxyl group, enhancing its solubility in organic solvents and potentially influencing its reactivity and biological activity. Additionally, the presence of a fluorine atom at the meta position introduces unique electronic properties, which can affect the compound's interaction with biological targets and its overall stability. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development and as a building block for more complex chemical syntheses. Its specific properties, such as melting point, boiling point, and solubility, would require further investigation through experimental data.

Formula: C₁₃H₁₁FO₂

InChI: InChI=1S/C13H11FO2/c1-16-13-5-3-2-4-10(13)9-6-7-12(15)11(14)8-9/h2-8,15H,1H3

InChI key: InChIKey=CEZYMZJAJNJBNZ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)C2=CC(F)=C(O)C=C2

Synonyms:

• 3-Fluoro-2′-methoxy-1,1′-biphenyl-4-ol
• [1,1′-Biphenyl]-4-ol, 3-fluoro-2′-methoxy-