CAS 1261895-44-6

3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid

Description:

3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including formyl (-CHO), hydroxyl (-OH), and carboxylic acid (-COOH) groups, which contribute to its chemical reactivity and potential applications. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The hydroxyl group provides hydrogen bonding capabilities, enhancing solubility in polar solvents and influencing its biological activity. The dicarboxylic acid nature of the compound suggests it can act as a ligand in coordination chemistry or as a building block in organic synthesis. Additionally, the structural features may impart specific optical properties, making it of interest in materials science and organic electronics. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a versatile molecule in both research and industrial applications.

Formula: C₁₅H₁₀O₆

InChI: InChI=1S/C15H10O6/c16-7-12-3-8(1-2-13(12)17)9-4-10(14(18)19)6-11(5-9)15(20)21/h1-7,17H,(H,18,19)(H,20,21)

InChI key: InChIKey=XTJFFNUUMVUESF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(C(O)=O)C1)C2=CC(C=O)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,5-dicarboxylic acid, 3′-formyl-4′-hydroxy-
• 3′-Formyl-4′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid