CymitQuimica logo

CAS 1261895-46-8

:

4-Fluoro-3-(5-hydroxy-3-pyridinyl)benzonitrile

Description:
4-Fluoro-3-(5-hydroxy-3-pyridinyl)benzonitrile is a chemical compound characterized by its complex structure, which includes a fluorobenzene moiety and a pyridine ring with a hydroxyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The hydroxyl group on the pyridine ring may contribute to hydrogen bonding capabilities, potentially affecting solubility and reactivity. This compound is often studied in the context of medicinal chemistry due to its potential pharmacological properties. Its nitrile functional group can serve as a versatile handle for further chemical modifications. Additionally, the compound's unique structural features may allow it to interact with specific biological targets, making it of interest in drug discovery and development. As with many organic compounds, its stability, reactivity, and interactions with other substances are influenced by its molecular structure and the functional groups present. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C12H7FN2O
InChI:InChI=1S/C12H7FN2O/c13-12-2-1-8(5-14)3-11(12)9-4-10(16)7-15-6-9/h1-4,6-7,16H
InChI key:InChIKey=OWWPOJXBFCDGQW-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C#N)=CC1)C=2C=C(O)C=NC2
Synonyms:
  • Benzonitrile, 4-fluoro-3-(5-hydroxy-3-pyridinyl)-
  • 4-Fluoro-3-(5-hydroxy-3-pyridinyl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.