
CAS 1261895-69-5
:5-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol
Description:
5-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol, identified by its CAS number 1261895-69-5, is an organic compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a phenolic moiety substituted with a fluorine atom and a hydroxyl group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the hydroxyl group contributes to its potential as a hydrogen bond donor. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions typical of phenolic and pyridine derivatives. Overall, 5-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol represents a class of compounds that could have applications in drug development and other chemical research areas.
Formula:C11H8FNO2
InChI:InChI=1S/C11H8FNO2/c12-8-1-2-10(11(15)4-8)7-3-9(14)6-13-5-7/h1-6,14-15H
InChI key:InChIKey=OSGZRIMRBVJBBH-UHFFFAOYSA-N
SMILES:OC1=C(C=2C=C(O)C=NC2)C=CC(F)=C1
Synonyms:- 5-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol
- 3-Pyridinol, 5-(4-fluoro-2-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.