CymitQuimica logo

CAS 1261895-70-8

:

(3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-yl)-1-piperidinylmethanone

Description:
(3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-yl)-1-piperidinylmethanone is a chemical compound characterized by its complex structure, which includes a biphenyl moiety substituted with a fluorine atom and a hydroxyl group, alongside a piperidinylmethanone functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the hydroxyl group can participate in hydrogen bonding, potentially affecting solubility and reactivity. The piperidinyl group contributes to the compound's overall basicity and may play a role in receptor interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed, especially when dealing with fluorinated compounds, which can exhibit unique toxicological profiles.
Formula:C18H18FNO2
InChI:InChI=1S/C18H18FNO2/c19-16-10-15(11-17(21)12-16)13-4-6-14(7-5-13)18(22)20-8-2-1-3-9-20/h4-7,10-12,21H,1-3,8-9H2
InChI key:InChIKey=KOXGJHFJBKFYKQ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(O)C1)C2=CC=C(C(=O)N3CCCCC3)C=C2
Synonyms:
  • Methanone, (3′-fluoro-5′-hydroxy[1,1′-biphenyl]-4-yl)-1-piperidinyl-
  • (3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-yl)-1-piperidinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.