
CAS 1261895-74-2
:2-(2-Methoxy-5-methylphenyl)-3-pyridinol
Description:
2-(2-Methoxy-5-methylphenyl)-3-pyridinol, identified by its CAS number 1261895-74-2, is an organic compound characterized by a pyridine ring substituted with a phenyl group that contains both a methoxy and a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the methyl group can affect the compound's steric properties and electronic distribution. As a pyridinol derivative, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Overall, the compound's unique combination of functional groups and structural characteristics contributes to its potential utility in various chemical and biological contexts.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c1-9-5-6-12(16-2)10(8-9)13-11(15)4-3-7-14-13/h3-8,15H,1-2H3
InChI key:InChIKey=WUOHSBNDMMNZJI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C)C=C1)C2=C(O)C=CC=N2
Synonyms:- 2-(2-Methoxy-5-methylphenyl)-3-pyridinol
- 3-Pyridinol, 2-(2-methoxy-5-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.