CymitQuimica logo

CAS 1261895-79-7

:

2-Hydroxy-5-(3-thienyl)benzonitrile

Description:
2-Hydroxy-5-(3-thienyl)benzonitrile is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring, which is further substituted with a thienyl group. The thienyl moiety, derived from thiophene, introduces sulfur into the structure, contributing to the compound's unique chemical properties. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The nitrile group may impart additional reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The presence of both the hydroxyl and nitrile functionalities suggests potential applications in pharmaceuticals or agrochemicals, where such groups can influence biological activity. Additionally, the thienyl substitution may enhance the compound's electronic properties, making it interesting for studies in materials science or organic electronics. Overall, 2-Hydroxy-5-(3-thienyl)benzonitrile presents a versatile framework for further chemical exploration and application.
Formula:C11H7NOS
InChI:InChI=1S/C11H7NOS/c12-6-10-5-8(1-2-11(10)13)9-3-4-14-7-9/h1-5,7,13H
InChI key:InChIKey=SSZFWEXAVOTWIG-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1O)C=2C=CSC2
Synonyms:
  • 2-Hydroxy-5-(3-thienyl)benzonitrile
  • Benzonitrile, 2-hydroxy-5-(3-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.