CymitQuimica logo

CAS 1261895-80-0

:

5-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone

Description:
5-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone is an organic compound characterized by its unique structure, which includes a pyridinone core and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical properties, such as increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The pyridinone moiety can participate in various chemical reactions, including tautomerization and coordination with metal ions, which may enhance its reactivity and utility in synthetic applications. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery and development. Overall, 5-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone represents a versatile scaffold for further research in both chemical synthesis and biological evaluation.
Formula:C12H10FNO2
InChI:InChI=1S/C12H10FNO2/c1-16-11-6-8(2-4-10(11)13)9-3-5-12(15)14-7-9/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=YSLMLLOWXPJVKY-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1F)C=2C=CC(=O)NC2
Synonyms:
  • 5-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-(4-fluoro-3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.