
CAS 1261895-81-1
:3-Hydroxy-5-(3-thienyl)benzonitrile
Description:
3-Hydroxy-5-(3-thienyl)benzonitrile is an organic compound characterized by its unique structural features, which include a hydroxyl group, a thienyl group, and a nitrile functional group. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the thienyl moiety introduces aromaticity and may influence the compound's electronic properties. The nitrile group, known for its strong electron-withdrawing characteristics, can enhance the compound's reactivity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural components, making it a subject of interest in medicinal chemistry and material science. Its molecular interactions can be influenced by the arrangement of substituents, which may affect its physical properties such as melting point, boiling point, and solubility. Additionally, the compound's stability and reactivity can be assessed through various analytical techniques, including spectroscopy and chromatography, which are essential for understanding its potential applications in various fields.
Formula:C11H7NOS
InChI:InChI=1S/C11H7NOS/c12-6-8-3-10(5-11(13)4-8)9-1-2-14-7-9/h1-5,7,13H
InChI key:InChIKey=WBJFDFDXDCSGKA-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=C(O)C1)C=2C=CSC2
Synonyms:- 3-Hydroxy-5-(3-thienyl)benzonitrile
- Benzonitrile, 3-hydroxy-5-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.