CAS 1261895-85-5

4-Bromo-N-butyl-2-ethoxybenzamide

Description:

4-Bromo-N-butyl-2-ethoxybenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the butyl group indicates that it has a hydrophobic character, which can influence its solubility in various solvents. The ethoxy group enhances its polarity, making it more soluble in polar solvents compared to non-polar ones. The benzamide structure suggests that it may exhibit biological activity, potentially acting as a pharmaceutical agent or a ligand in biochemical interactions. The compound's molecular structure allows for various intermolecular interactions, such as hydrogen bonding, which can affect its physical properties, including melting and boiling points. Additionally, the bromine substituent can provide sites for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Overall, 4-Bromo-N-butyl-2-ethoxybenzamide is a compound of interest in both research and industrial applications due to its unique characteristics.

Formula: C₁₃H₁₈BrNO₂

InChI: InChI=1S/C13H18BrNO2/c1-3-5-8-15-13(16)11-7-6-10(14)9-12(11)17-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,15,16)

InChI key: InChIKey=BHCHGZFZZXIKAV-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C(NCCCC)=O)C=CC(Br)=C1

Synonyms:

• Benzamide, 4-bromo-N-butyl-2-ethoxy-
• 4-Bromo-N-butyl-2-ethoxybenzamide

Butyl 4-bromo-2-ethoxybenzamide

CAS: 1261895-85-5

Formula: C₁₃H₁₈BrNO₂

Molecular weight: 300.1915

Ref: IN-DA000S3U