CymitQuimica logo

CAS 1261895-89-9

:

3-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone

Description:
3-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone, identified by its CAS number 1261895-89-9, is an organic compound characterized by its complex structure, which includes a pyridinone ring and a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of hydroxymethyl and carbonyl functional groups. The pyridinone moiety may contribute to its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the hydroxymethyl group can enhance its reactivity and interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities or therapeutic effects. Further studies would be necessary to fully elucidate its properties and potential uses in various chemical and biological contexts.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c14-8-9-3-1-4-10(7-9)11-5-2-6-13-12(11)15/h1-7,14H,8H2,(H,13,15)
InChI key:InChIKey=KKCVSRPFZZGWQP-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC(CO)=CC=C2)=CC=CN1
Synonyms:
  • 3-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 3-[3-(hydroxymethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.