
CAS 1261895-90-2
:4-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-fluorobenzoic acid
Description:
4-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-fluorobenzoic acid, identified by its CAS number 1261895-90-2, is a chemical compound that features a fluorobenzoic acid moiety substituted with a pyridine derivative. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may influence biological activity. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the pyridine ring may contribute to interactions with biological targets. The carboxylic acid functional group is likely to impart acidic properties, making it soluble in polar solvents. Additionally, the compound may exhibit specific reactivity patterns due to the presence of the carbonyl group in the pyridine ring. Overall, this compound's unique structure suggests potential utility in drug development, particularly in the design of pharmaceuticals targeting various biological pathways. Further studies would be necessary to elucidate its specific properties and biological activities.
Formula:C12H8FNO3
InChI:InChI=1S/C12H8FNO3/c13-10-6-7(3-4-9(10)12(16)17)8-2-1-5-14-11(8)15/h1-6H,(H,14,15)(H,16,17)
InChI key:InChIKey=UHRSQTVPLMVZTH-UHFFFAOYSA-N
SMILES:O=C1C(=CC=CN1)C2=CC(F)=C(C(O)=O)C=C2
Synonyms:- 4-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-fluorobenzoic acid
- Benzoic acid, 4-(1,2-dihydro-2-oxo-3-pyridinyl)-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.