CAS 1261895-94-6

Methyl 2-fluoro-4-(3-hydroxy-2-pyridinyl)benzoate

Description:

Methyl 2-fluoro-4-(3-hydroxy-2-pyridinyl)benzoate, identified by its CAS number 1261895-94-6, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. The presence of a fluorine atom at the 2-position of the aromatic ring and a hydroxyl group on a pyridine ring contributes to its unique chemical properties, including potential polar interactions and hydrogen bonding capabilities. This compound may exhibit moderate lipophilicity due to the aromatic structure, which can influence its solubility in organic solvents. The hydroxyl group on the pyridine ring can enhance its reactivity and potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structural features suggest it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Overall, Methyl 2-fluoro-4-(3-hydroxy-2-pyridinyl)benzoate represents a complex molecule with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₃H₁₀FNO₃

InChI: InChI=1S/C13H10FNO3/c1-18-13(17)9-5-4-8(7-10(9)14)12-11(16)3-2-6-15-12/h2-7,16H,1H3

InChI key: InChIKey=VUQDLJYUULSSHB-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(F)=C(C(OC)=O)C=C2)N=CC=C1

Synonyms:

• Benzoic acid, 2-fluoro-4-(3-hydroxy-2-pyridinyl)-, methyl ester
• Methyl 2-fluoro-4-(3-hydroxy-2-pyridinyl)benzoate