
CAS 1261895-97-9
:Methyl 2-fluoro-4-(5-hydroxy-3-pyridinyl)benzoate
Description:
Methyl 2-fluoro-4-(5-hydroxy-3-pyridinyl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety, a fluorine atom, and a pyridine ring with a hydroxyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The hydroxyl group on the pyridine ring may contribute to hydrogen bonding capabilities, potentially affecting solubility and reactivity. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups present. Methyl esters, like this compound, are often used in medicinal chemistry and can serve as intermediates in the synthesis of more complex molecules. Additionally, the presence of the pyridine ring suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting various biological pathways. Overall, Methyl 2-fluoro-4-(5-hydroxy-3-pyridinyl)benzoate represents a versatile structure with potential implications in both synthetic and medicinal chemistry.
Formula:C13H10FNO3
InChI:InChI=1S/C13H10FNO3/c1-18-13(17)11-3-2-8(5-12(11)14)9-4-10(16)7-15-6-9/h2-7,16H,1H3
InChI key:InChIKey=QXHLRWRZSQDWLU-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(OC)=O)C=2C=C(O)C=NC2
Synonyms:- Benzoic acid, 2-fluoro-4-(5-hydroxy-3-pyridinyl)-, methyl ester
- Methyl 2-fluoro-4-(5-hydroxy-3-pyridinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.