CAS 1261896-16-5

6′-Chloro[1,1′-biphenyl]-2,3′-diol

Description:

6′-Chloro[1,1′-biphenyl]-2,3′-diol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 6′ position and hydroxyl groups at the 2 and 3′ positions contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest that it could participate in hydrogen bonding, influencing its interactions in various chemical environments. The chlorinated and hydroxylated nature of this compound may also impart unique properties, such as potential antimicrobial or antioxidant activities, making it of interest in medicinal chemistry and materials science. Additionally, its structural features may allow for various synthetic modifications, enabling the exploration of derivatives with tailored properties for specific applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₂H₉ClO₂

InChI: InChI=1S/C12H9ClO2/c13-11-6-5-8(14)7-10(11)9-3-1-2-4-12(9)15/h1-7,14-15H

InChI key: InChIKey=PEVLPUZLBZIRMM-UHFFFAOYSA-N

SMILES: ClC1=C(C=C(O)C=C1)C2=C(O)C=CC=C2

Synonyms:

• [1,1′-Biphenyl]-2,3′-diol, 6′-chloro-
• 6′-Chloro[1,1′-biphenyl]-2,3′-diol