CAS 1261896-17-6
:4-(2,5-Dichlorophenyl)-2(1H)-pyridinone
Description:
4-(2,5-Dichlorophenyl)-2(1H)-pyridinone, identified by its CAS number 1261896-17-6, is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. This compound contains a dichlorophenyl substituent, indicating the presence of two chlorine atoms on the phenyl ring at the 2 and 5 positions, contributing to its chemical reactivity and potential biological activity. The presence of chlorine atoms typically enhances lipophilicity and can influence the compound's interaction with biological targets. The pyridinone moiety is known for its ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and solubility would depend on the specific conditions and solvents used.
Formula:C11H7Cl2NO
InChI:InChI=1S/C11H7Cl2NO/c12-8-1-2-10(13)9(6-8)7-3-4-14-11(15)5-7/h1-6H,(H,14,15)
InChI key:InChIKey=BYHCHRZKOROJFM-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(=O)NC=C2)C=C(Cl)C=C1
Synonyms:- 2(1H)-Pyridinone, 4-(2,5-dichlorophenyl)-
- 4-(2,5-Dichlorophenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
