CAS 1261896-21-2

4-(3-Hydroxy-2-pyridinyl)-N,N-dimethylbenzamide

Description:

4-(3-Hydroxy-2-pyridinyl)-N,N-dimethylbenzamide, identified by its CAS number 1261896-21-2, is a chemical compound characterized by its structural features, which include a benzamide core substituted with a dimethylamino group and a pyridine ring that possesses a hydroxyl group. This compound exhibits properties typical of amides, such as potential hydrogen bonding due to the presence of the hydroxyl group and the amide nitrogen. The pyridine moiety contributes to its aromatic character and may influence its solubility and reactivity. Additionally, the presence of the hydroxyl group can enhance its polarity, affecting its interaction with biological systems and solvents. This compound may be of interest in medicinal chemistry due to its potential biological activity, which could be explored in various therapeutic contexts. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present in its structure.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1S/C14H14N2O2/c1-16(2)14(18)11-7-5-10(6-8-11)13-12(17)4-3-9-15-13/h3-9,17H,1-2H3

InChI key: InChIKey=WXHFZEBOSVWJQI-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC=C(C(N(C)C)=O)C=C2)N=CC=C1

Synonyms:

• Benzamide, 4-(3-hydroxy-2-pyridinyl)-N,N-dimethyl-
• 4-(3-Hydroxy-2-pyridinyl)-N,N-dimethylbenzamide