CAS 1261896-43-8

3′-Chloro-4′-methoxy[1,1′-biphenyl]-2-ol

Description:

3′-Chloro-4′-methoxy[1,1′-biphenyl]-2-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a methoxy group at the 4′ position on one of the phenyl rings, along with a hydroxyl group at the 2 position, contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, and may participate in various chemical reactions, including electrophilic substitutions due to the electron-donating nature of the methoxy group. Its solubility and stability can be influenced by the presence of these functional groups. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological properties and interactions. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated and phenolic structures.

Formula: C₁₃H₁₁ClO₂

InChI: InChI=1S/C13H11ClO2/c1-16-13-7-6-9(8-11(13)14)10-4-2-3-5-12(10)15/h2-8,15H,1H3

InChI key: InChIKey=HUAPGVFDMKSDAN-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(Cl)=C(OC)C=C2)C=CC=C1

Synonyms:

• [1,1′-Biphenyl]-2-ol, 3′-chloro-4′-methoxy-
• 3′-Chloro-4′-methoxy[1,1′-biphenyl]-2-ol