CymitQuimica logo

CAS 1261896-52-9

:

5-(3-Aminophenyl)-2-pyridinecarboxylic acid

Description:
5-(3-Aminophenyl)-2-pyridinecarboxylic acid, identified by its CAS number 1261896-52-9, is an organic compound characterized by the presence of both a pyridine and an amino group within its structure. This compound features a pyridine ring substituted with a carboxylic acid group and an aniline moiety, which contributes to its potential biological activity. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents and influencing its reactivity. The carboxylic acid functionality provides acidic properties, allowing for potential interactions in various chemical environments. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its structural features suggest potential applications in materials science and organic synthesis. Overall, 5-(3-Aminophenyl)-2-pyridinecarboxylic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c13-10-3-1-2-8(6-10)9-4-5-11(12(15)16)14-7-9/h1-7H,13H2,(H,15,16)
InChI key:InChIKey=BVACGTUHDQGCRT-UHFFFAOYSA-N
SMILES:NC=1C=C(C=2C=CC(C(O)=O)=NC2)C=CC1
Synonyms:
  • 2-Pyridinecarboxylic acid, 5-(3-aminophenyl)-
  • 5-(3-Aminophenyl)-2-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.