CymitQuimica logo

CAS 1261896-58-5

:

3′-(1-Pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-ol

Description:
3′-(1-Pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 2-position of the biphenyl moiety contributes to its potential as a phenolic compound, which can exhibit various biological activities. The sulfonyl group, linked to a pyrrolidine moiety, enhances the compound's solubility and reactivity, making it suitable for various applications in medicinal chemistry. The pyrrolidine ring introduces a nitrogen atom, which can participate in hydrogen bonding and influence the compound's pharmacokinetic properties. Overall, this compound may exhibit interesting pharmacological properties, potentially acting as a scaffold for drug development, particularly in the fields of neuropharmacology or anti-inflammatory research. Its specific interactions and efficacy would depend on further studies, including structure-activity relationship analyses.
Formula:C16H17NO3S
InChI:InChI=1S/C16H17NO3S/c18-16-9-2-1-8-15(16)13-6-5-7-14(12-13)21(19,20)17-10-3-4-11-17/h1-2,5-9,12,18H,3-4,10-11H2
InChI key:InChIKey=QZZGHPXKVKSIIO-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC(S(=O)(=O)N3CCCC3)=CC=C2)C=CC=C1
Synonyms:
  • 3′-(1-Pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-ol
  • [1,1′-Biphenyl]-2-ol, 3′-(1-pyrrolidinylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.