CymitQuimica logo

CAS 1261896-65-4

:

1,6-Dihydro-5-(4-hydroxyphenyl)-6-oxo-3-pyridinecarboxylic acid

Description:
1,6-Dihydro-5-(4-hydroxyphenyl)-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions to enhance its biological activity. This compound features a hydroxyl group on the phenyl ring, contributing to its potential as a bioactive molecule. The presence of both a carboxylic acid and a keto group in the structure suggests that it may exhibit acidic properties and participate in various chemical reactions, such as esterification or amidation. Its molecular framework indicates potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The compound's solubility and stability can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry. Overall, 1,6-Dihydro-5-(4-hydroxyphenyl)-6-oxo-3-pyridinecarboxylic acid represents a class of compounds that may offer significant therapeutic benefits, warranting further investigation into its biological activities and mechanisms of action.
Formula:C12H9NO4
InChI:InChI=1S/C12H9NO4/c14-9-3-1-7(2-4-9)10-5-8(12(16)17)6-13-11(10)15/h1-6,14H,(H,13,15)(H,16,17)
InChI key:InChIKey=WKMCZQDNJKLTHF-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C2=CC=C(O)C=C2
Synonyms:
  • 1,6-Dihydro-5-(4-hydroxyphenyl)-6-oxo-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 1,6-dihydro-5-(4-hydroxyphenyl)-6-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.