CAS 1261896-73-4

2-Chloro-5-(3-fluoro-2-methylphenyl)-4-pyridinecarboxylic acid

Description:

2-Chloro-5-(3-fluoro-2-methylphenyl)-4-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and various substituents that contribute to its chemical properties. The presence of a chloro group and a fluoro group indicates that this compound may exhibit unique reactivity and solubility characteristics, often influencing its behavior in biological systems or chemical reactions. The carboxylic acid functional group suggests that it can participate in acid-base reactions and may serve as a ligand in coordination chemistry. Additionally, the presence of aromatic rings typically imparts stability and can affect the compound's electronic properties. This compound may be of interest in pharmaceutical research or materials science due to its potential biological activity and the role of halogenated compounds in drug design. Overall, its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₃H₉ClFNO₂

InChI: InChI=1S/C13H9ClFNO2/c1-7-8(3-2-4-11(7)15)10-6-16-12(14)5-9(10)13(17)18/h2-6H,1H3,(H,17,18)

InChI key: InChIKey=CQZSMAWUMZVRKM-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(Cl)C1)C2=C(C)C(F)=CC=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-chloro-5-(3-fluoro-2-methylphenyl)-
• 2-Chloro-5-(3-fluoro-2-methylphenyl)-4-pyridinecarboxylic acid