CAS 1261896-76-7
:6-(5-Fluoro-2-methylphenyl)-2-pyridinecarboxylic acid
Description:
6-(5-Fluoro-2-methylphenyl)-2-pyridinecarboxylic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its chemical properties, influencing its reactivity and potential applications. This compound is likely to exhibit moderate polarity due to the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The fluorine substitution may also impart specific electronic effects, potentially affecting the compound's biological activity. As a pyridine derivative, it may exhibit properties relevant to medicinal chemistry, such as antimicrobial or anti-inflammatory activities. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 6-(5-Fluoro-2-methylphenyl)-2-pyridinecarboxylic acid represents a class of compounds with diverse applications in pharmaceuticals and agrochemicals.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-8-5-6-9(14)7-10(8)11-3-2-4-12(15-11)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=FEALANGWKJAJPK-UHFFFAOYSA-N
SMILES:CC1=C(C=2N=C(C(O)=O)C=CC2)C=C(F)C=C1
Synonyms:- 6-(5-Fluoro-2-methylphenyl)-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 6-(5-fluoro-2-methylphenyl)-
- 6-(5-Fluoro-2-methylphenyl)picolinic acid
- 6-(5-fluoro-2-methylphenyl)pyridine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
