CymitQuimica logo

CAS 1261897-09-9

:

5-Methyl-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-ol

Description:
5-Methyl-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position contributes to its classification as a phenolic compound, influencing its reactivity and solubility in polar solvents. The trifluoromethoxy group (-O-CF3) at the 4′ position enhances the compound's lipophilicity and may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The methyl group at the 5-position adds to the steric bulk and can affect the compound's overall stability and interaction with biological targets. This compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 5-Methyl-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is notable for its potential applications in synthetic chemistry and material science.
Formula:C14H11F3O2
InChI:InChI=1S/C14H11F3O2/c1-9-6-11(8-12(18)7-9)10-2-4-13(5-3-10)19-14(15,16)17/h2-8,18H,1H3
InChI key:InChIKey=VEUQFLBLBGWJCQ-UHFFFAOYSA-N
SMILES:CC=1C=C(C2=CC=C(OC(F)(F)F)C=C2)C=C(O)C1
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 5-methyl-4′-(trifluoromethoxy)-
  • 5-Methyl-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.