CymitQuimica logo

CAS 1261897-14-6

:

3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:
3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a hydroxy group at the 4′ position on one of the phenyl rings contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carbonitrile functional group at the 3 position enhances its polarity and can influence its solubility and interaction with biological systems. This compound may exhibit specific biological activities due to its structural features, making it of interest for research in medicinal chemistry. Additionally, the presence of halogen and hydroxyl groups can affect its physical properties, such as melting point and boiling point, as well as its stability under different conditions. Overall, 3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3-carbonitrile is a compound with diverse potential applications, warranting further investigation into its properties and uses.
Formula:C13H8ClNO
InChI:InChI=1S/C13H8ClNO/c14-12-7-11(4-5-13(12)16)10-3-1-2-9(6-10)8-15/h1-7,16H
InChI key:InChIKey=KGIGYOVKKMMLFT-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1O)C2=CC(C#N)=CC=C2
Synonyms:
  • 3′-Chloro-4′-hydroxy[1,1′-biphenyl]-3-carbonitrile
  • [1,1′-Biphenyl]-3-carbonitrile, 3′-chloro-4′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.