
CAS 1261897-20-4
:2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde
Description:
2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2' position and a hydroxy group at the 4' position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The aldehyde functional group at the 2-position of the biphenyl framework introduces reactivity typical of aldehydes, such as the ability to undergo oxidation and condensation reactions. This compound may exhibit interesting biological activity due to the presence of the hydroxy and fluoro substituents, which can influence its interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, where modifications to biphenyl derivatives are often explored for enhanced properties. Overall, 2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde represents a versatile compound with diverse potential applications.
Formula:C13H9FO2
InChI:InChI=1S/C13H9FO2/c14-13-7-10(16)5-6-12(13)11-4-2-1-3-9(11)8-15/h1-8,16H
InChI key:InChIKey=BPSJIWZCPMNQSG-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)C2=C(F)C=C(O)C=C2
Synonyms:- 2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde
- [1,1′-Biphenyl]-2-carboxaldehyde, 2′-fluoro-4′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.