
CAS 1261897-30-6
:3′,5,5′-Trichloro[1,1′-biphenyl]-3-ol
Description:
3′,5,5′-Trichloro[1,1′-biphenyl]-3-ol, identified by its CAS number 1261897-30-6, is a chlorinated organic compound characterized by the presence of three chlorine atoms and a hydroxyl group attached to a biphenyl structure. This compound exhibits properties typical of chlorinated phenolic compounds, including potential hydrophobicity and lipophilicity, which can influence its behavior in biological systems and the environment. The presence of chlorine substituents can enhance its stability and resistance to degradation, making it persistent in various ecosystems. Additionally, the hydroxyl group contributes to its potential for hydrogen bonding, affecting its solubility in polar solvents. Such compounds are often studied for their environmental impact, particularly in relation to their toxicity and bioaccumulation potential. The specific arrangement of chlorine atoms and the hydroxyl group can also influence its reactivity and interaction with biological targets, which is crucial for understanding its ecological and health implications.
Formula:C12H7Cl3O
InChI:InChI=1S/C12H7Cl3O/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8/h1-6,16H
InChI key:InChIKey=GGVMXVWIWMKLDA-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(Cl)C1)C2=CC(Cl)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 3′,5,5′-trichloro-
- 3′,5,5′-Trichloro[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.