
CAS 1261897-58-8
:5-Bromo-2′-chloro-5′-methoxy[1,1′-biphenyl]-3-ol
Description:
5-Bromo-2′-chloro-5′-methoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by its complex biphenyl structure, which includes a hydroxyl group (-OH), a bromine atom, a chlorine atom, and a methoxy group (-OCH3) attached to the biphenyl framework. This compound is typically classified as a halogenated phenolic compound, which may exhibit various biological activities, including potential antimicrobial or anti-inflammatory properties. The presence of multiple substituents on the biphenyl ring can influence its solubility, reactivity, and interaction with biological systems. Its molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, affecting its physical properties such as melting point and boiling point. Additionally, the halogen substituents can enhance the compound's stability and reactivity in certain chemical reactions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.
Formula:C13H10BrClO2
InChI:InChI=1S/C13H10BrClO2/c1-17-11-2-3-13(15)12(7-11)8-4-9(14)6-10(16)5-8/h2-7,16H,1H3
InChI key:InChIKey=VKLJNCCPVBFGMH-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(OC)=CC1)C2=CC(Br)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-bromo-2′-chloro-5′-methoxy-
- 5-Bromo-2′-chloro-5′-methoxy[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.