CymitQuimica logo

CAS 1261897-62-4

:

5-Bromo-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:
5-Bromo-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with various halogen and functional groups. The presence of a bromine atom and a fluorine atom indicates its potential reactivity and influence on the compound's physical properties, such as solubility and boiling point. The trifluoromethyl group contributes to its lipophilicity and may enhance its biological activity. The hydroxyl (-OH) group at the 3-position of the biphenyl structure suggests that the compound may exhibit hydrogen bonding capabilities, affecting its interactions in biological systems. This compound may be of interest in fields such as medicinal chemistry and materials science due to its unique electronic properties and potential applications in pharmaceuticals or agrochemicals. Its specific reactivity and stability would depend on the surrounding conditions, including solvent and temperature. Overall, the combination of halogen substituents and functional groups makes this compound a subject of interest for further research and application.
Formula:C13H7BrF4O
InChI:InChI=1S/C13H7BrF4O/c14-8-4-7(5-9(19)6-8)10-2-1-3-11(12(10)15)13(16,17)18/h1-6,19H
InChI key:InChIKey=JYODDLMGLZIFKN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(F)C(=CC=C1)C2=CC(Br)=CC(O)=C2
Synonyms:
  • 5-Bromo-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 5-bromo-2′-fluoro-3′-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.