
CAS 1261897-70-4
:3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-methanol
Description:
3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-methanol, identified by its CAS number 1261897-70-4, is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3′ position and a trifluoromethoxy group (-O-CF3) at the 5′ position contributes to its unique chemical properties, including potential polarity and reactivity. The methanol group at the 2-position further enhances its solubility in polar solvents. This compound may exhibit interesting biological activities due to the presence of the trifluoromethoxy group, which can influence its interaction with biological targets. Additionally, the trifluoromethoxy moiety is known to enhance metabolic stability and lipophilicity, making it a subject of interest in medicinal chemistry. Overall, the combination of functional groups in this compound suggests potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical activities would require further investigation.
Formula:C14H11F3O3
InChI:InChI=1S/C14H11F3O3/c15-14(16,17)20-12-6-10(5-11(19)7-12)13-4-2-1-3-9(13)8-18/h1-7,18-19H,8H2
InChI key:InChIKey=WDNNBUYJOYERBW-UHFFFAOYSA-N
SMILES:C(O)C1=C(C=CC=C1)C2=CC(OC(F)(F)F)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-2-methanol, 3′-hydroxy-5′-(trifluoromethoxy)-
- 3′-Hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-2-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.