CymitQuimica logo

CAS 1261897-88-4

:

2′,5′-Dichloro-3-fluoro[1,1′-biphenyl]-4-ol

Description:
2′,5′-Dichloro-3-fluoro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and one fluorine atom on the biphenyl framework, along with a hydroxyl (-OH) group, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the biphenyl structure, which can influence its solubility in organic solvents. The chlorine and fluorine substituents can also impart specific reactivity and stability characteristics, making it of interest in various chemical applications, including potential use in pharmaceuticals or agrochemicals. Additionally, the hydroxyl group may participate in hydrogen bonding, affecting its interactions with other molecules. As with many halogenated compounds, it is essential to consider environmental and health implications, as halogenated organic compounds can exhibit toxicity and persistence in the environment.
Formula:C12H7Cl2FO
InChI:InChI=1S/C12H7Cl2FO/c13-8-2-3-10(14)9(6-8)7-1-4-12(16)11(15)5-7/h1-6,16H
InChI key:InChIKey=WWHMNFUZPVKVCU-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(F)=C(O)C=C2)C=C(Cl)C=C1
Synonyms:
  • 2′,5′-Dichloro-3-fluoro[1,1′-biphenyl]-4-ol
  • [1,1′-Biphenyl]-4-ol, 2′,5′-dichloro-3-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.