CAS 1261897-90-8

5-Fluoro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol

Description:

5-Fluoro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by the presence of a fluoro group and a methylsulfonyl moiety attached to a biphenyl structure. This compound features a hydroxyl (-OH) group, which contributes to its potential as a polar molecule, influencing its solubility and reactivity. The fluorine atom typically enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The methylsulfonyl group can enhance the compound's stability and solubility in various solvents. The biphenyl framework provides rigidity and can influence the compound's interactions with biological targets. Overall, the unique combination of functional groups in 5-Fluoro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. Its structural characteristics may also allow for further modifications to optimize its properties for various applications in chemical research and drug development.

Formula: C₁₃H₁₁FO₃S

InChI: InChI=1S/C13H11FO3S/c1-18(16,17)13-4-2-3-9(7-13)10-5-11(14)8-12(15)6-10/h2-8,15H,1H3

InChI key: InChIKey=PNYROGKRSHTQIT-UHFFFAOYSA-N

SMILES: FC=1C=C(C=C(O)C1)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 5-fluoro-3′-(methylsulfonyl)-
• 5-Fluoro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol