CAS 1261897-96-4

4′-Formyl-4-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:

4′-Formyl-4-hydroxy[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1261897-96-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO) and a hydroxyl group (-OH) at the para positions of one of the phenyl rings, along with a cyano group (-CN) at the meta position of the other ring. These functional groups contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Additionally, the cyano group can participate in nucleophilic reactions, making this compound a valuable intermediate in the synthesis of various organic compounds. Its unique structure and functional groups may also impart specific optical or electronic properties, which could be explored in fields such as dye chemistry or pharmaceuticals.

Formula: C₁₄H₉NO₂

InChI: InChI=1S/C14H9NO2/c15-8-13-7-12(5-6-14(13)17)11-3-1-10(9-16)2-4-11/h1-7,9,17H

InChI key: InChIKey=LTQQLQAABOEUAO-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1O)C2=CC=C(C=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 4′-formyl-4-hydroxy-
• 4′-Formyl-4-hydroxy[1,1′-biphenyl]-3-carbonitrile