CymitQuimica logo

CAS 1261898-17-2

:

3′-Formyl-4′-hydroxy-N-methyl[1,1′-biphenyl]-3-carboxamide

Description:
3′-Formyl-4′-hydroxy-N-methyl[1,1′-biphenyl]-3-carboxamide is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO) and a hydroxy group (-OH) at specific positions on the biphenyl framework, contributing to its reactivity and potential applications in organic synthesis. The presence of the N-methyl group indicates that a methyl group is attached to the nitrogen atom of the amide functional group, which can influence the compound's solubility and biological activity. The carboxamide functional group (-CONH2) enhances its potential for hydrogen bonding, affecting its interactions in various chemical environments. This compound may exhibit interesting properties such as fluorescence or biological activity, making it a candidate for research in fields like medicinal chemistry or materials science. Its specific characteristics, including melting point, solubility, and reactivity, would require empirical data for precise evaluation.
Formula:C15H13NO3
InChI:InChI=1S/C15H13NO3/c1-16-15(19)12-4-2-3-10(7-12)11-5-6-14(18)13(8-11)9-17/h2-9,18H,1H3,(H,16,19)
InChI key:InChIKey=YYYQGQFLYZCSID-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1O)C2=CC(C(NC)=O)=CC=C2
Synonyms:
  • 3′-Formyl-4′-hydroxy-N-methyl[1,1′-biphenyl]-3-carboxamide
  • [1,1′-Biphenyl]-3-carboxamide, 3′-formyl-4′-hydroxy-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.