CAS 1261899-12-0

5-Amino-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Amino-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including an amino group (-NH2), a methoxy group (-OCH3), and a trifluoromethyl group (-CF3), contributing to its unique chemical properties. The presence of the carboxylic acid group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the methoxy group can affect the compound's solubility and reactivity. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and reactivity would depend on the surrounding environment and the presence of other functional groups.

Formula: C₁₅H₁₂F₃NO₃

InChI: InChI=1S/C15H12F3NO3/c1-22-13-3-2-10(15(16,17)18)7-12(13)8-4-9(14(20)21)6-11(19)5-8/h2-7H,19H2,1H3,(H,20,21)

InChI key: InChIKey=AOBHJAORZLOUPG-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(C(F)(F)F)C=C1)C2=CC(C(O)=O)=CC(N)=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-2′-methoxy-5′-(trifluoromethyl)-
• 5-Amino-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid