
CAS 1261899-15-3
:2-Amino-5-(5-carboxy-3-thienyl)-4-pyridinecarboxylic acid
Description:
2-Amino-5-(5-carboxy-3-thienyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261899-15-3, is a heterocyclic compound featuring both pyridine and thiophene moieties. This compound is characterized by the presence of multiple functional groups, including amino, carboxylic acid, and pyridinecarboxylic acid groups, which contribute to its potential as a bioactive molecule. The thienyl group enhances its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature exhibit polar characteristics due to the presence of carboxylic acid groups, which can engage in hydrogen bonding and ionic interactions. This compound may also demonstrate interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural complexity allows for various synthetic modifications, which could lead to derivatives with enhanced biological activity or selectivity. Overall, 2-Amino-5-(5-carboxy-3-thienyl)-4-pyridinecarboxylic acid represents a unique scaffold for the development of new therapeutic agents.
Formula:C11H8N2O4S
InChI:InChI=1S/C11H8N2O4S/c12-9-2-6(10(14)15)7(3-13-9)5-1-8(11(16)17)18-4-5/h1-4H,(H2,12,13)(H,14,15)(H,16,17)
InChI key:InChIKey=DZYSWPJFGWWBKG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=C(N)C1)C=2C=C(C(O)=O)SC2
Synonyms:- 2-Amino-5-(5-carboxy-3-thienyl)-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 2-amino-5-(5-carboxy-3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.