CAS 1261899-34-6

3-Chloro-2′,4′-dimethoxy[1,1′-biphenyl]-4-ol

Description:

3-Chloro-2′,4′-dimethoxy[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 4-position of one of the phenyl rings contributes to its potential as a phenolic compound, which may exhibit various biological activities. The compound also features two methoxy groups (-OCH3) at the 2′ and 4′ positions, enhancing its lipophilicity and possibly influencing its reactivity and solubility in organic solvents. The chlorine substituent at the 3-position introduces additional electronic effects, which can affect the compound's chemical behavior and interactions. Overall, this compound may be of interest in fields such as medicinal chemistry and materials science, where the manipulation of aromatic systems is crucial for developing new drugs or functional materials. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed literature reference for precise characterization.

Formula: C₁₄H₁₃ClO₃

InChI: InChI=1S/C14H13ClO3/c1-17-10-4-5-11(14(8-10)18-2)9-3-6-13(16)12(15)7-9/h3-8,16H,1-2H3

InChI key: InChIKey=WZMIIGXRGFGRSQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(OC)=C1)C2=CC(Cl)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 3-chloro-2′,4′-dimethoxy-
• 3-Chloro-2′,4′-dimethoxy[1,1′-biphenyl]-4-ol