
CAS 1261899-64-2
:2-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
Description:
2-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261899-64-2, is a chemical compound that features a complex structure comprising a pyridine ring and a phenyl group with a dimethylamino carbonyl substituent. This compound is characterized by its potential as a pharmaceutical intermediate or active ingredient, often explored for its biological activity. The presence of the dimethylamino group suggests it may exhibit basic properties, influencing its solubility and reactivity in various solvents. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, the compound's structural features may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability, solubility, and reactivity would be assessed through various analytical techniques. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.
Formula:C15H14N2O3
InChI:InChI=1S/C15H14N2O3/c1-17(2)14(18)11-6-3-5-10(9-11)13-12(15(19)20)7-4-8-16-13/h3-9H,1-2H3,(H,19,20)
InChI key:InChIKey=KQVPFCGFNLHHJW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=CC(C(N(C)C)=O)=CC=C2
Synonyms:- 3-Pyridinecarboxylic acid, 2-[3-[(dimethylamino)carbonyl]phenyl]-
- 2-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.