
CAS 1261899-67-5
:2-[4-(Ethoxycarbonyl)phenyl]-3-pyridinecarboxylic acid
Description:
2-[4-(Ethoxycarbonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261899-67-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and an ethoxycarbonyl group attached to a phenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It is likely to be a solid at room temperature, with solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The presence of both the ethoxycarbonyl and pyridine functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these groups can influence biological activity and solubility. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, making it a versatile intermediate in organic synthesis. Its specific reactivity and applications would depend on the functional groups and the overall molecular structure, which can be further explored through experimental studies.
Formula:C15H13NO4
InChI:InChI=1S/C15H13NO4/c1-2-20-15(19)11-7-5-10(6-8-11)13-12(14(17)18)4-3-9-16-13/h3-9H,2H2,1H3,(H,17,18)
InChI key:InChIKey=ODZNQSITYZBMQL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=CC=C(C(OCC)=O)C=C2
Synonyms:- 2-[4-(Ethoxycarbonyl)phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[4-(ethoxycarbonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.