CymitQuimica logo

CAS 1261899-69-7

:

6-[2-Fluoro-4-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:
6-[2-Fluoro-4-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid, with the CAS number 1261899-69-7, is a chemical compound characterized by its complex structure that includes a pyridine ring and a phenyl group substituted with a fluorine atom and a methoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions, potentially forming salts or esters. The fluorine atom may influence the compound's electronic properties, enhancing its reactivity or altering its interaction with biological targets. Additionally, the methoxycarbonyl group can provide sites for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-20-14(19)8-2-4-10(11(15)6-8)12-5-3-9(7-16-12)13(17)18/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=RGKBUXXGFKMHRL-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(OC)=O)=C1)C2=CC=C(C(O)=O)C=N2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-[2-fluoro-4-(methoxycarbonyl)phenyl]-
  • 6-[2-Fluoro-4-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.