
CAS 1261899-72-2
:2-Amino-5-[2-fluoro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid
Description:
2-Amino-5-[2-fluoro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) indicates that it is an amino acid derivative, which can participate in various chemical reactions, including peptide bond formation. The fluorine atom in the phenyl ring contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological targets. The methoxycarbonyl group (-COOCH3) enhances its solubility and may affect its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that could have applications in pharmaceuticals or agrochemicals due to its structural features.
Formula:C14H11FN2O4
InChI:InChI=1S/C14H11FN2O4/c1-21-14(20)7-2-3-8(11(15)4-7)10-6-17-12(16)5-9(10)13(18)19/h2-6H,1H3,(H2,16,17)(H,18,19)
InChI key:InChIKey=MYYBOBCQMSUROJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=C(N)C1)C2=C(F)C=C(C(OC)=O)C=C2
Synonyms:- 2-Amino-5-[2-fluoro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 2-amino-5-[2-fluoro-4-(methoxycarbonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.