CAS 1261899-93-7

4-(2-Formylphenyl)-3-pyridinecarboxylic acid

Description:

4-(2-Formylphenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261899-93-7, is an organic compound characterized by its complex structure that includes both a pyridine and a phenyl group. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The presence of the formyl group indicates that it can participate in condensation reactions, making it useful in synthetic organic chemistry. Additionally, the pyridine ring can engage in coordination with metal ions, suggesting potential applications in coordination chemistry or catalysis. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its practical applications. Overall, 4-(2-Formylphenyl)-3-pyridinecarboxylic acid is notable for its potential utility in organic synthesis and materials science, particularly in the development of functionalized compounds or ligands.

Formula: C₁₃H₉NO₃

InChI: InChI=1S/C13H9NO3/c15-8-9-3-1-2-4-10(9)11-5-6-14-7-12(11)13(16)17/h1-8H,(H,16,17)

InChI key: InChIKey=VJYHFPJWWTVRJG-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C=CC=C1)C=2C(C(O)=O)=CN=CC2

Synonyms:

• 4-(2-Formylphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-(2-formylphenyl)-