CymitQuimica logo

CAS 1261900-26-8

:

2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-4-carboxylic acid

Description:
2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-4-carboxylic acid, with the CAS number 1261900-26-8, is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH) that contribute to its polar nature, enhancing its solubility in polar solvents. The presence of a methylsulfonylamino group (-SO2-CH3) introduces additional functional properties, potentially influencing its reactivity and biological activity. The compound's structural features suggest it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular interactions could be significant in various applications, including drug development and synthesis. Overall, the unique combination of functional groups and the biphenyl framework provides a basis for exploring its chemical behavior and potential uses in various fields.
Formula:C15H15NO5S
InChI:InChI=1S/C15H15NO5S/c1-21-14-9-11(15(17)18)6-7-13(14)10-4-3-5-12(8-10)16-22(2,19)20/h3-9,16H,1-2H3,(H,17,18)
InChI key:InChIKey=PJLOLEXLRUWTDI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=CC(NS(C)(=O)=O)=CC=C2)C=CC(C(O)=O)=C1
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 2-methoxy-3′-[(methylsulfonyl)amino]-
  • 2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.