
CAS 1261900-29-1
:5-Bromo-3′-fluoro-4′-methyl[1,1′-biphenyl]-3-ol
Description:
5-Bromo-3′-fluoro-4′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 5-position and a fluorine atom at the 3′-position introduces significant electronegative elements, influencing the compound's reactivity and polarity. Additionally, the hydroxyl group (-OH) at the 3-position contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and may exhibit antioxidant properties. The methyl group at the 4′-position adds to the compound's hydrophobic character. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features that can affect its biological activity and chemical behavior. Its specific interactions and applications would depend on the context of its use, including potential roles in synthesis or as a building block in more complex chemical systems.
Formula:C13H10BrFO
InChI:InChI=1S/C13H10BrFO/c1-8-2-3-9(6-13(8)15)10-4-11(14)7-12(16)5-10/h2-7,16H,1H3
InChI key:InChIKey=YRACFNXYGPQVKX-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(O)C1)C2=CC(F)=C(C)C=C2
Synonyms:- 5-Bromo-3′-fluoro-4′-methyl[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-bromo-3′-fluoro-4′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.