CymitQuimica logo

CAS 1261900-30-4

:

4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-ol

Description:
4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 2-position of the biphenyl framework contributes to its classification as a phenolic compound, which can exhibit various chemical properties such as acidity and reactivity towards electrophiles. The trifluoromethyl group (-CF3) at the 3′ position and the fluoro group (-F) at the 4′ position significantly influence the compound's electronic properties, enhancing its lipophilicity and potentially affecting its biological activity. This compound may be of interest in fields such as medicinal chemistry and materials science due to its unique substituents, which can modulate interactions with biological targets or influence the physical properties of polymers. Additionally, the presence of fluorine atoms often imparts stability and resistance to metabolic degradation, making such compounds valuable in pharmaceutical applications.
Formula:C13H8F4O
InChI:InChI=1S/C13H8F4O/c14-11-6-5-8(7-10(11)13(15,16)17)9-3-1-2-4-12(9)18/h1-7,18H
InChI key:InChIKey=XQRPTSKSUDSLTJ-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC(C(F)(F)F)=C(F)C=C2)C=CC=C1
Synonyms:
  • 4′-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-ol
  • [1,1′-Biphenyl]-2-ol, 4′-fluoro-3′-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.