CymitQuimica logo

CAS 1261900-31-5

:

2-Methoxy-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid

Description:
2-Methoxy-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple aromatic substituents. This compound features a methoxy group and a carboxylic acid functional group, contributing to its potential as a versatile building block in organic synthesis. The presence of the phenylmethoxy group enhances its lipophilicity, which may influence its solubility and reactivity in various solvents. The pyridine moiety can participate in coordination chemistry and may exhibit basic properties due to the nitrogen atom in the ring. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such derivatives may exhibit biological activity. Its unique combination of functional groups allows for various chemical reactions, including esterification and substitution, making it a valuable compound for further research and development in organic and medicinal chemistry.
Formula:C20H17NO4
InChI:InChI=1S/C20H17NO4/c1-24-19-18(20(22)23)11-16(12-21-19)15-8-5-9-17(10-15)25-13-14-6-3-2-4-7-14/h2-12H,13H2,1H3,(H,22,23)
InChI key:InChIKey=DNHBAYUCIKZAJG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC(OCC3=CC=CC=C3)=CC=C2
Synonyms:
  • 2-Methoxy-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-methoxy-5-[3-(phenylmethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.