CAS 1261900-35-9
:6-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
Description:
6-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261900-35-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features a phenylmethoxy group attached to a phenyl ring, contributing to its potential as a pharmaceutical or agrochemical agent. The presence of the carboxylic acid group suggests that it can participate in various chemical reactions, including esterification and acid-base reactions. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the pyridine moiety. Additionally, its potential applications could be explored in drug development, particularly in targeting specific biological pathways or receptors. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial in the field of organic chemistry and drug design.
Formula:C19H15NO3
InChI:InChI=1S/C19H15NO3/c21-19(22)16-8-11-18(20-12-16)15-6-9-17(10-7-15)23-13-14-4-2-1-3-5-14/h1-12H,13H2,(H,21,22)
InChI key:InChIKey=KXAUSBINFYIFLA-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=CC=C(C=C2)C3=CC=C(C(O)=O)C=N3
Synonyms:- 3-Pyridinecarboxylic acid, 6-[4-(phenylmethoxy)phenyl]-
- 6-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
