CAS 1261900-68-8

1-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)ethanone

Description:

1-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)ethanone, with the CAS number 1261900-68-8, is an organic compound characterized by its biphenyl structure, which features a hydroxyl group and a methoxy group on the aromatic rings. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity due to the presence of the hydroxyl group. The ethanone functional group contributes to its reactivity, allowing for various chemical transformations. It is likely to be soluble in organic solvents and may exhibit moderate solubility in water, depending on the pH and other conditions. The presence of methoxy and hydroxyl groups suggests that it may participate in hydrogen bonding, influencing its physical properties like melting and boiling points. Additionally, this compound may have applications in pharmaceuticals or materials science, given the structural motifs that are often associated with biological activity or functional properties. However, specific data on its toxicity, stability, and reactivity would require further investigation or empirical studies.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-10(16)11-4-3-5-12(8-11)13-6-7-14(17)15(9-13)18-2/h3-9,17H,1-2H3

InChI key: InChIKey=HBUDZVKJYAVKED-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1O)C2=CC(C(C)=O)=CC=C2

Synonyms:

• 1-(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)ethanone
• Ethanone, 1-(4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-