
CAS 1261900-70-2
:6-[3-(Methylsulfonyl)phenyl]-3-pyridinol
Description:
6-[3-(Methylsulfonyl)phenyl]-3-pyridinol, identified by its CAS number 1261900-70-2, is an organic compound characterized by its pyridine and phenyl functional groups. This compound features a pyridinol structure, which includes a hydroxyl group (-OH) attached to the pyridine ring, contributing to its potential as a weak acid. The presence of a methylsulfonyl group (-SO2CH3) on the phenyl ring enhances its solubility in polar solvents and may influence its reactivity and biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both heteroatoms and functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Overall, 6-[3-(Methylsulfonyl)phenyl]-3-pyridinol represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C12H11NO3S
InChI:InChI=1S/C12H11NO3S/c1-17(15,16)11-4-2-3-9(7-11)12-6-5-10(14)8-13-12/h2-8,14H,1H3
InChI key:InChIKey=NZXUYDRARZQEKI-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C=C(C=CC1)C2=CC=C(O)C=N2
Synonyms:- 3-Pyridinol, 6-[3-(methylsulfonyl)phenyl]-
- 6-[3-(Methylsulfonyl)phenyl]-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.